1-naphthaleneacetic acid is a naphthylacetic acid substituted by a carboxymethyl group at position 1. It has a role as a synthetic auxin. It is a conjugate acid of a 1-naphthaleneacetate.
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
1-naphthaleneacetic acid is a naphthylacetic acid substituted by a carboxymethyl group at position 1. It has a role as a synthetic auxin. It is a conjugate acid of a 1-naphthaleneacetate.
| Fiziksel görünüm | White odorless solid; [Hawley] White or beige powder; [MSDSonline] |
| Renk / Form | Needles from water |
| Koku | Odorless |
| Erime noktası | 134.5-135.5 °C |
| Kaynama noktası | Decomposes |
| Çözünürlük | Slightly soluble in ethanol, trifluoroacetic acid; soluble in benzene and acetic acid; very soluble in ethyl ether, acetone, and chloroform. |
| Buhar basıncı | 0.0000159 [mmHg] |
| Kararlılık | /Aqueous solution of sodium salt is/ very unstable to UV and sunlight irradiation. /Aqueous solution of sodium salt/ |
| IUPAC Adı | 2-naphthalen-1-ylacetic acid |
| Молекулалық формула | C12H10O2 |
| Молекулалық салмақ | 186.21 g/mol |
| CAS | 86-87-3 |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CC(=O)O |
| InChIKey | PRPINYUDVPFIRX-UHFFFAOYSA-N |
| Katalog No | KC.-1510056 |
| Ambalaj seçenekleri | 25GM · 100GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.