Ethidium bromide is the organic bromide salt of ethidium. It has a role as a geroprotector, an intercalator and a trypanocidal drug. It contains an ethidium.
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
Ethidium bromide is the organic bromide salt of ethidium. It has a role as a geroprotector, an intercalator and a trypanocidal drug. It contains an ethidium.
| Fiziksel görünüm | Dark red solid; [Merck Index] Red to brown solid; [ICSC] Dark red powder; [Sigma-Aldrich MSDS] |
| Renk / Form | Dark red crystals from alcohol |
| Erime noktası | 260-262 °C (decomposes) |
| Parlama noktası | >100 °C |
| Yoğunluk | 0.34 g/cm³ |
| Çözünürlük | Solubility in 2-methoxyethanol is 20 mg/mL; ethanol, 2 mg/mL |
| Buhar basıncı | 1.2X10-12 mm Hg at 25 °C /Estimated/ |
| IUPAC Adı | 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine bromide |
| Молекулалык формула | C21H20BrN3 |
| Молекулалык салмак | 394.3 g/mol |
| CAS | 1239-45-8 |
| SMILES | CC[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)N)N.[Br-] |
| InChIKey | ZMMJGEGLRURXTF-UHFFFAOYSA-N |
| Katalog No | KC.510056 |
| Ambalaj seçenekleri | 1GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.