(+)-Lactose contains a Lactosylceramide motif and is often attached to a Cer aglycon.
(+)-Lactose contains a Lactosylceramide motif and is often attached to a Cer aglycon.
| Fiziksel görünüm | Lactose is a white hard crystalline powder. (NTP, 1992) |
| Renk / Form | White, hard, crystalline mass of white powder |
| Koku | Odorless |
| Erime noktası | 433 °F (NTP, 1992) |
| Yoğunluk | 1.525 |
| Çözünürlük | 50 to 100 mg/mL at 68 °F (NTP, 1992) |
| IUPAC Adı | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| Молекулалык формула | C12H22O11 |
| Молекулалык салмак | 342.30 g/mol |
| CAS | 63-42-3 |
| SMILES | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](OC([C@@H]([C@H]2O)O)O)CO)O)O)O)O |
| InChIKey | GUBGYTABKSRVRQ-QKKXKWKRSA-N |
| Katalog No | KC.1210053 |
| Ambalaj seçenekleri | 500GM |