Ammonium pentaborate is an odorless white solid. Sinks and mixes slowly with water. (USCG, 1999)
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
Ammonium pentaborate is an odorless white solid. Sinks and mixes slowly with water. (USCG, 1999)
| Fiziksel görünüm | Ammonium pentaborate is an odorless white solid. Sinks and mixes slowly with water. (USCG, 1999) |
| Yoğunluk | 1.58 at 59 °F (USCG, 1999) - Denser than water; will sink |
| Çözünürlük | Colorless solid; specific gravity: 1.57 at 20 °C; solubility in water: 4% at 0 °C; 7.07% at 20 °C; 14.4% at 50 °C /Ammonium pentaborate tetrahydrate/ |
| IUPAC Adı | azanium (7-oxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonan-3-yl)oxy-oxoborane |
| Molekül Formülü | B5H4NO8 |
| Molekül Ağırlığı | 200.1 g/mol |
| CAS | 12007-89-5 |
| SMILES | B(=O)OB1OB2OB(OB(O2)O1)[O-].[NH4+] |
| InChIKey | OEAWHXRHGIIPBU-UHFFFAOYSA-O |
| Katalog No | KC.110212 |
| Ambalaj seçenekleri | 500GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.