L-Phenylalanine is a metabolite found in or produced by Saccharomyces cerevisiae.
L-Phenylalanine is a metabolite found in or produced by Saccharomyces cerevisiae.
| Fiziksel görünüm | L-phenylalanine is an odorless white crystalline powder. Slightly bitter taste. pH (1% aqueous solution) 5.4 to 6. (NTP, 1992) |
| Renk / Form | Prisms form water |
| Koku | Slight |
| Erime noktası | 541 °F (decomposes) (NTP, 1992) |
| Kaynama noktası | 563 °F at 760 mmHg (sublimes) (NTP, 1992) |
| Çözünürlük | 10 to 50 mg/mL at 77 °F (NTP, 1992) |
| Buhar basıncı | 0.00000005 [mmHg] |
| IUPAC Adı | (2S)-2-amino-3-phenylpropanoic acid |
| Molekül Formülü | C9H11NO2 |
| Molekül Ağırlığı | 165.19 g/mol |
| CAS | 63-91-2 |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)N |
| InChIKey | COLNVLDHVKWLRT-QMMMGPOBSA-N |
| Katalog No | KC.1210139 |
| Ambalaj seçenekleri | 25GM · 100GM |