Zinc nitrate is an inorganic nitrate salt having zinc(2+) as the couterion. It has a role as a NMR chemical shift reference compound. It is an inorganic zinc salt and an inorganic nitrate salt. It contains a zinc(2+).
Oksitleyici
Aşındırıcı
Tahriş edici
Çevresel tehlike
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
Zinc nitrate is an inorganic nitrate salt having zinc(2+) as the couterion. It has a role as a NMR chemical shift reference compound. It is an inorganic zinc salt and an inorganic nitrate salt. It contains a zinc(2+).
| Fiziksel görünüm | Zinc nitrate is a colorless crystalline solid. Noncombustible, but accelerates the burning of combustible materials. If large quantities are involved in a fire or the combustible material is finely… |
| Renk / Form | White powder |
| Erime noktası | 97 °F (USCG, 1999) |
| Yoğunluk | 2.07 at 68 °F (USCG, 1999) - Denser than water; will sink |
| Çözünürlük | SOLUBILITY: 184.3 G/100 CC WATER @ 20 °C /HEXAHYDRATE/ |
| IUPAC Adı | zinc dinitrate |
| Molekül Formülü | N2O6Zn |
| Molekül Ağırlığı | 189.4 g/mol |
| CAS | 7779-88-6 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Zn+2] |
| InChIKey | ONDPHDOFVYQSGI-UHFFFAOYSA-N |
| Katalog No | KC.2610013 |
| Ambalaj seçenekleri | 500GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.