Dioctyl sodium sulfosuccinate is an odorless colorless to white waxy solid. Sinks and mixes slowly with water. (USCG, 1999)
Tahriş edici
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
Dioctyl sodium sulfosuccinate is an odorless colorless to white waxy solid. Sinks and mixes slowly with water. (USCG, 1999)
| Fiziksel görünüm | Dioctyl sodium sulfosuccinate is an odorless colorless to white waxy solid. Sinks and mixes slowly with water. (USCG, 1999) |
| Erime noktası | 311 °F (USCG, 1999) |
| Yoğunluk | 1.1 at 68 °F (solid or liquid) (USCG, 1999) - Denser than water; will sink |
| IUPAC Adı | sodium 1,4-dioctoxy-1,4-dioxobutane-2-sulfonate |
| Molekulýar formula | C20H37NaO7S |
| Molekulýar agram | 444.6 g/mol |
| CAS | 1639-66-3 |
| SMILES | CCCCCCCCOC(=O)CC(C(=O)OCCCCCCCC)S(=O)(=O)[O-].[Na+] |
| InChIKey | RCIJACVHOIKRAP-UHFFFAOYSA-M |
| Katalog No | KC.410107 |
| Ambalaj seçenekleri | 500GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.