Tahriş edici
Sağlık tehlikesi
Çevresel tehlike
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
Lead oxalate is a chemical compound of lead. Lead is a heavy metal and stable element with the symbol Pb and the atomic number 82, existing in metallic, organic, and inorganic forms. It is mainly found in nature as the mineral galena (PbS), cerussite (PbCO3) or anglesite (PbSO4), usually in ore with zinc, silver, or copper. (L21)
| Fiziksel görünüm | White solid; [Merck Index] |
| IUPAC Adı | lead(2+);oxalate |
| Molekulýar formula | C2O4Pb |
| Molekulýar agram | 295 g/mol |
| CAS | 814-93-7 |
| SMILES | C(=O)(C(=O)[O-])[O-].[Pb+2] |
| InChIKey | FCHAMWMIYDDXFS-UHFFFAOYSA-L |
| Katalog No | KC.1210081 |
| Ambalaj seçenekleri | 500GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.
