2-nitrophenol is a yellow solid. Sinks in and mixes slowly with water. (USCG, 1999)
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
2-nitrophenol is a yellow solid. Sinks in and mixes slowly with water. (USCG, 1999)
| Fiziksel görünüm | 2-nitrophenol is a yellow solid. Sinks in and mixes slowly with water. (USCG, 1999) |
| Renk / Form | Light yellow needles or prisms |
| Koku | Peculiar, aromatic color |
| Erime noktası | 113 to 115 °F (NTP, 1992) |
| Kaynama noktası | 417 to 421 °F at 760 mmHg (Decomposes) (NTP, 1992) |
| Parlama noktası | 108 °C c.c. |
| Yoğunluk | 1.49 at 68 °F (USCG, 1999) - Denser than water; will sink |
| Çözünürlük | less than 1 mg/mL at 70 °F (NTP, 1992) |
| Buhar basıncı | 1 mmHg at 120.7 °F (NTP, 1992) |
| Kırılma indisi | Index of refraction: 1.5723 at 50 °C/D |
| IUPAC Adı | 2-nitrophenol |
| Molekulýar formula | C6H5NO3 |
| Molekulýar agram | 139.11 g/mol |
| CAS | 88-75-5 |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])O |
| InChIKey | IQUPABOKLQSFBK-UHFFFAOYSA-N |
| Katalog No | KC.1510017 |
| Ambalaj seçenekleri | 500GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.