Minute crystals or white powder. pH of aqueous solutions 5.6 to 7.0 or even higher (a 10% solution, made from a commercial grade, may have a pH of 7.4 to 7.7). (NTP, 1992)
Minute crystals or white powder. pH of aqueous solutions 5.6 to 7.0 or even higher (a 10% solution, made from a commercial grade, may have a pH of 7.4 to 7.7). (NTP, 1992)
| Fiziksel görünüm | Minute crystals or white powder. pH of aqueous solutions 5.6 to 7.0 or even higher (a 10% solution, made from a commercial grade, may have a pH of 7.4 to 7.7). (NTP, 1992) |
| Renk / Form | Minute crystals |
| Koku | Odorless |
| Erime noktası | 424 °F (decomposes) (NTP, 1992) |
| Çözünürlük | greater than or equal to 100 mg/mL at 63 °F (NTP, 1992) |
| Kararlılık | Aqueous solutions are unstable and subject to quick oxidation by air at pH > 6.0 |
| IUPAC Adı | sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2H-furan-3-olate |
| Molekulýar formula | C6H7NaO6 |
| Molekulýar agram | 198.11 g/mol |
| CAS | 134-03-2 |
| SMILES | C([C@@H]([C@@H]1C(=C(C(=O)O1)O)[O-])O)O.[Na+] |
| InChIKey | PPASLZSBLFJQEF-RXSVEWSESA-M |
| Katalog No | KC.1910117 |
| Ambalaj seçenekleri | 100GM · 500GM |