⚠️ For information only; not a substitute for the official Safety Data Sheet (SDS).
| Appearance | White crystalline powder |
| Odor | Odorless |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 236.33 g/mol |
| Melting Point | 179-181 °C |
| Density | 1.3 g/cm³ |
| Solubility | Slightly soluble in water, soluble in ethanol and acetone |
| Flash Point | Not applicable |
| Chemical Stability | Stable under normal conditions, but decomposes when exposed to light |
| IUPAC Name | (2Z,4E)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| الصيغة الجزيئية | C15H20O4 |
| الكتلة الجزيئية | 236.33 g/mol g/mol |
| SMILES | CC1=CC(=O)CC(C1(C=CC(=CC(=O)O)C)O)(C)C |
| InChIKey | JLIDBLDQVAYHNE-YKALOCIXSA-N |
⚠️ For information only; not a substitute for the official SDS.