⚠️ For information only; not a substitute for the official Safety Data Sheet (SDS).
| Appearance | White crystalline powder |
| Odor | Odorless |
| Molecular Formula | C7H5NaO2 |
| Molecular Weight | 144.11 g/mol |
| Melting Point | 300 °C |
| Density | 1.44 g/cm³ |
| Solubility | Soluble in water |
| Flash Point | Not applicable |
| Chemical Stability | Stable under normal conditions, but sensitive to light and heat |
| IUPAC Name | sodium benzoate |
| الصيغة الجزيئية | C7H5NaO2 |
| الكتلة الجزيئية | 144.11 g/mol g/mol |
| SMILES | C1=CC=C(C=C1)C(=O)[O-].[Na+] |
| InChIKey | WXMKPNITSTVMEF-UHFFFAOYSA-M |
⚠️ For information only; not a substitute for the official SDS.