Brucine is an organic heteroheptacyclic compound and a monoterpenoid indole alkaloid.
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
Brucine is an organic heteroheptacyclic compound and a monoterpenoid indole alkaloid.
| Fiziksel görünüm | Brucine appears as a white crystalline solid. Combustible but may require some effort to ignite. Toxic by inhalation (vapor, dust, etc.) and ingestion. |
| Renk / Form | Needles from acetone + water |
| Koku | Odorless |
| Erime noktası | 352 °F (NTP, 1992) |
| Kaynama noktası | 470 °C |
| Yoğunluk | greater than 1 at 68 °F (USCG, 1999) |
| Çözünürlük | Crystals. Sol in water or alcohol. The solns are neutral or slightly acid. /Hydrochloride/ |
| Kararlılık | Stable /during transport/. |
| IUPAC Adı | (4aR,5aS,8aR,13aS,15aS,15bR)-10,11-dimethoxy-4a,5,5a,7,8,13a,15,15a,15b,16-decahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one |
| الصيغة الجزيئية | C23H26N2O4 |
| الكتلة الجزيئية | 394.5 g/mol |
| CAS | 357-57-3 |
| SMILES | COC1=C(C=C2C(=C1)[C@]34CCN5[C@H]3C[C@@H]6[C@@H]7[C@@H]4N2C(=O)C[C@@H]7OCC=C6C5)OC |
| InChIKey | RRKTZKIUPZVBMF-IBTVXLQLSA-N |
| Katalog No | KC.210204 |
| Ambalaj seçenekleri | 10GM · 25GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.