Tricresyl phosphate appears as a colorless,odorless liquid. Insoluble in water and slightly denser than water. Toxic by ingestion and skin absorption. Used to make plastics and lubricants.
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
Tricresyl phosphate appears as a colorless,odorless liquid. Insoluble in water and slightly denser than water. Toxic by ingestion and skin absorption. Used to make plastics and lubricants.
| Fiziksel görünüm | Tri-p-tolyl phosphate is a crystalline solid. (NTP, 1992) |
| Renk / Form | Needles from alcohol; tablets from ethanol |
| Koku | Odorless |
| Erime noktası | 171 to 172 °F (NTP, 1992) |
| Kaynama noktası | 435 °F at 3.5 mmHg (NTP, 1992) |
| Parlama noktası | 437 °F (NTP, 1992) |
| Yoğunluk | 1.247 at 77 °F (NTP, 1992) - Denser than water; will sink |
| Çözünürlük | Insoluble (NTP, 1992) |
| Buhar basıncı | 1.7e-06 mmHg at 77 °F (NTP, 1992) |
| Kırılma indisi | Index of refraction: 1.556 at 25 °C |
| Kararlılık | Stable, non-volatile /Tricresyl phosphate/ |
| IUPAC Adı | tris(4-methylphenyl) phosphate |
| الصيغة الجزيئية | C21H21O4P |
| الكتلة الجزيئية | 368.4 g/mol |
| CAS | 78-32-0 |
| SMILES | CC1=CC=C(C=C1)OP(=O)(OC2=CC=C(C=C2)C)OC3=CC=C(C=C3)C |
| InChIKey | BOSMZFBHAYFUBJ-UHFFFAOYSA-N |
| Katalog No | KC.2010168 |
| Ambalaj seçenekleri | 500ML |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.