3,6-Diamino-10-methylacridinium chloride mixt. with 3,6-acridinediamine. Fluorescent dye used as a local antiseptic and also as a biological stain. It intercalates into nucleic acids thereby inhibiting bacterial and viral replication.
3,6-Diamino-10-methylacridinium chloride mixt. with 3,6-acridinediamine. Fluorescent dye used as a local antiseptic and also as a biological stain. It intercalates into nucleic acids thereby inhibiting bacterial and viral replication.
| Fiziksel görünüm | Brown to orange powder; Green fluorescence when diluted in water; [Hawley] |
| IUPAC Adı | acridine-3,6-diamine;10-methylacridin-10-ium-3,6-diamine;chloride |
| Summenformel | C27H25ClN6 |
| Molekulargewicht | 469.0 g/mol |
| CAS | 65589-70-0 |
| SMILES | C[N+]1=C2C=C(C=CC2=CC3=C1C=C(C=C3)N)N.C1=CC(=CC2=NC3=C(C=CC(=C3)N)C=C21)N.[Cl-] |
| InChIKey | PEJLNXHANOHNSU-UHFFFAOYSA-N |
| Katalog No | KC.110061 |
| Ambalaj seçenekleri | 5gm · 25gm |