Citric acid is a metabolite found in or produced by Saccharomyces cerevisiae.
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
Citric acid is a metabolite found in or produced by Saccharomyces cerevisiae.
| Fiziksel görünüm | Citric acid appears as colorless, odorless crystals with an acid taste. Denser than water. (USCG, 1999) |
| Renk / Form | Crystals; monoclinic holohedra; crystallizes from hot concentrated aqueous solution |
| Koku | Odorless |
| Erime noktası | 307 °F (anhydrous) (NTP, 1992) |
| Kaynama noktası | Decomposes (NTP, 1992) |
| Parlama noktası | 100 °C |
| Yoğunluk | 1.54 at 68 °F (USCG, 1999) - Denser than water; will sink |
| Çözünürlük | greater than or equal to 100 mg/mL at 72 °F (NTP, 1992) |
| Kırılma indisi | INDEX OF REFRACTION: 1.493, 1.498, 1.509 @ 20 °C /CITRIC ACID HYDRATE/ |
| IUPAC Adı | 2-hydroxypropane-1,2,3-tricarboxylic acid |
| Summenformel | C6H8O7 |
| Molekulargewicht | 192.12 g/mol |
| CAS | 77-92-9 |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| InChIKey | KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| Katalog No | KC.310215 |
| Ambalaj seçenekleri | 500GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.