Guanidine nitrate is a nitrate of guanidine. It is a high energy fuel used in some gas generator and solid rocket propellant applications. Nitrite is a toxic compound known to cause methemoglobinemia. (L1137, L1627)
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
Guanidine nitrate is a nitrate of guanidine. It is a high energy fuel used in some gas generator and solid rocket propellant applications. Nitrite is a toxic compound known to cause methemoglobinemia. (L1137, L1627)
| Fiziksel görünüm | Guanidine nitrate appears as a white crystalline solid. Soluble in water. Takes some effort to ignite but once ignited it burns with increasing vigor as the fire progresses. If contaminated with co… |
| Renk / Form | Crystalline powder |
| Erime noktası | 214 °C |
| Kaynama noktası | Decomposes at boiling point |
| Yoğunluk | 1.436 g/cm³ |
| Çözünürlük | Sol in 10 parts water; sol in alcohol |
| IUPAC Adı | guanidine;nitric acid |
| Summenformel | CH6N4O3 |
| Molekulargewicht | 122.08 g/mol |
| CAS | 506-93-4 |
| SMILES | C(=N)(N)N.[N+](=O)(O)[O-] |
| InChIKey | CNUNWZZSUJPAHX-UHFFFAOYSA-N |
| Katalog No | KC.710052 |
| Ambalaj seçenekleri | 250GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.