Sodium Ascorbate is the sodium salt of ascorbic acid supplied as a white crystalline powder.
- Meat Processing: Curing accelerator and antioxidant (E301).
- Food Industry: Antioxidant.
- Supplements: Vitamin C source.
- Pharmaceuticals: Active and excipient.
| Appearance | White crystalline powder |
| Odor | Odorless |
| Molecular Formula | C6H7NaO6 |
| Molecular Weight | 198.11 g/mol |
| Melting Point | 218 °C (decomposes) |
| Solubility | 62 g/100 mL water at 25 °C |
| IUPAC Name | sodium (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2H-furan-3-olate |
| Молекулярная формула | C6H7NaO6 |
| Молекулярная масса | 198.11 g/mol |
| SMILES | C([C@@H]([C@@H]1C(=C(C(=O)O1)O)[O-])O)O.[Na+] |
| InChIKey | PPASLZSBLFJQEF-RXSVEWSESA-M |
