2,6-Dichlorophenolindophenol sodium salt is an organic molecular entity.
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
2,6-Dichlorophenolindophenol sodium salt is an organic molecular entity.
| Fiziksel görünüm | Dark green solid; [Merck Index] Dark green crystalline powder; [Carolina Biological Supply MSDS] |
| Çözünürlük | >43.5 [ug/mL] (The mean of the results at pH 7.4) |
| IUPAC Adı | sodium 4-[(3,5-dichloro-4-oxocyclohexa-2,5-dien-1-ylidene)amino]phenolate |
| Молекулярная формула | C12H6Cl2NNaO2 |
| Молекулярная масса | 290.07 g/mol |
| CAS | 620-45-1 |
| SMILES | C1=CC(=CC=C1N=C2C=C(C(=O)C(=C2)Cl)Cl)[O-].[Na+] |
| InChIKey | CVSUAFOWIXUYQA-UHFFFAOYSA-M |
| Katalog No | KC.-1410028 |
| Ambalaj seçenekleri | 10GM · 25GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.