Copper(II) nitrate is an inorganic nitrate salt having copper(2+) as the couterion. It contains a copper(2+).
Oksitleyici
Aşındırıcı
Akut toksik
Tahriş edici
Çevresel tehlike
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
Copper(II) nitrate is an inorganic nitrate salt having copper(2+) as the couterion. It contains a copper(2+).
| Fiziksel görünüm | Obtained as a trihydrate and as a hexahydrate. Both are blue crystalline solids. Used in medicine, as an insecticide, in chemical analysis, in making light sensitive papers. Toxic oxides of nitroge… |
| Renk / Form | Large, blue-green, orthorhombic crystals |
| Erime noktası | 238.1 °F (USCG, 1999) |
| Kaynama noktası | Sublimes |
| Yoğunluk | 2.32 at 68 °F (USCG, 1999) - Denser than water; will sink |
| Çözünürlük | 137.8 g/100 cc water @ 0 °C, 1270 g/100 cc water @ 100 °C, 100 g/100 cc alcohol @ 12.5 °C, very slightly sol in liq ammonia /Cupric nitrate trihydrate/ |
| IUPAC Adı | copper dinitrate |
| Молекулярная формула | CuN2O6 |
| Молекулярная масса | 187.56 g/mol |
| CAS | 3251-23-8 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Cu+2] |
| InChIKey | XTVVROIMIGLXTD-UHFFFAOYSA-N |
| Katalog No | KC.310256 |
| Ambalaj seçenekleri | 250GM · 500GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.