Aşındırıcı
Tahriş edici
Sağlık tehlikesi
Çevresel tehlike
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
Metanil yellow is an organic sodium salt having 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonate as the counterion. Used in one variant of Masson's trichrome to stain collagen yellow in contrast to the red muscle, but is not in common used. It has a role as a histological dye. It contains a 3-[(4-anilinophenyl)diazenyl]benzene-1-sulfonate.
| IUPAC Adı | sodium 3-[(4-anilinophenyl)diazenyl]benzenesulfonate |
| Молекулярная формула | C18H14N3NaO3S |
| Молекулярная масса | 375.4 g/mol |
| CAS | 587-98-4 |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)N=NC3=CC(=CC=C3)S(=O)(=O)[O-].[Na+] |
| InChIKey | NYGZLYXAPMMJTE-UHFFFAOYSA-M |
| Katalog No | KC.1310137 |
| Ambalaj seçenekleri | 25GM · 100GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.
