A bright bluish pink compound that has been used as a dye, biological stain, and diagnostic aid.
A bright bluish pink compound that has been used as a dye, biological stain, and diagnostic aid.
| Melting Point | Decomposes |
| IUPAC Name | dipotassium;2,3,4,5-tetrachloro-6-(2,4,5,7-tetraiodo-3-oxido-6-oxoxanthen-9-yl)benzoate |
| Molecular Formula | C20H2Cl4I4K2O5 |
| Molecular Weight | 1049.8 g/mol |
| CAS | 11121-48-5 |
| SMILES | C1=C2C(=C3C=C(C(=O)C(=C3OC2=C(C(=C1I)[O-])I)I)I)C4=C(C(=C(C(=C4Cl)Cl)Cl)Cl)C(=O)[O-].[K+].[K+] |
| InChIKey | AZJPTIGZZTZIDR-UHFFFAOYSA-L |
| Catalog No | KC.1810021 |
| Pack sizes | 25GM · 100GM |