Nitrobarite is a mineral with formula of Ba(N5+O3)2 or Ba(NO3)2. The IMA symbol is Nba.
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
Nitrobarite is a mineral with formula of Ba(N5+O3)2 or Ba(NO3)2. The IMA symbol is Nba.
| Fiziksel görünüm | Barium nitrate appears as a white crystalline solid. Noncombustible, but accelerates burning of combustible materials. If large quantities are involved in fire or the combustible material is finely… |
| Renk / Form | White cubic crystals |
| Koku | Odorless |
| Erime noktası | 1098 °F (USCG, 1999) |
| Kaynama noktası | Decomposes (NIOSH, 2024) |
| Yoğunluk | 3.24 at 73.4 °F (USCG, 1999) - Denser than water; will sink |
| Çözünürlük | 9 % (NIOSH, 2024) |
| Buhar basıncı | Low (NIOSH, 2024) |
| IUPAC Adı | barium(2+) dinitrate |
| Formule moléculaire | BaN2O6 |
| Masse moléculaire | 261.34 g/mol |
| CAS | 10022-31-8 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Ba+2] |
| InChIKey | IWOUKMZUPDVPGQ-UHFFFAOYSA-N |
| Katalog No | KC.210025 |
| Ambalaj seçenekleri | 500GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.