2-hydroxy-4-methoxybenzophenone appears as white to off-white or light yellow powder. (NTP, 1992)
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
2-hydroxy-4-methoxybenzophenone appears as white to off-white or light yellow powder. (NTP, 1992)
| Fiziksel görünüm | 2-hydroxy-4-methoxybenzophenone appears as white to off-white or light yellow powder. (NTP, 1992) |
| Renk / Form | Colorless crystals |
| Koku | Weak odor |
| Erime noktası | 151 °F (NTP, 1992) |
| Kaynama noktası | 302 to 320 °F at 5 mmHg (NTP, 1992) |
| Parlama noktası | 100 °C (212 °F) - closed cup |
| Yoğunluk | 1.32 at 25 °C |
| Çözünürlük | less than 1 mg/mL at 68 °F (NTP, 1992) |
| Buhar basıncı | 0.00000142 [mmHg] |
| Kararlılık | Stable under recommended storage conditions. |
| IUPAC Adı | (2-hydroxy-4-methoxyphenyl)-phenylmethanone |
| Formule moléculaire | C14H12O3 |
| Masse moléculaire | 228.24 g/mol |
| CAS | 131-57-7 |
| SMILES | COC1=CC(=C(C=C1)C(=O)C2=CC=CC=C2)O |
| InChIKey | DXGLGDHPHMLXJC-UHFFFAOYSA-N |
| Katalog No | KC.210075 |
| Ambalaj seçenekleri | 500GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.