Bile salt is a sodium salt of the conjugate of any bile acid with either glycine or taurine. It is a cholanoid and an organic sodium salt.
Bile salt is a sodium salt of the conjugate of any bile acid with either glycine or taurine. It is a cholanoid and an organic sodium salt.
| IUPAC Adı | 4-[(3R,5S,7R,12S)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Formule moléculaire | C24H40O5 |
| Masse moléculaire | 408.6 g/mol |
| SMILES | CC(CCC(=O)O)C1CCC2C1([C@H](CC3C2[C@@H](C[C@H]4C3(CC[C@H](C4)O)C)O)O)C |
| InChIKey | BHQCQFFYRZLCQQ-UMZBRFQRSA-N |
| Katalog No | KC.210101 |
| Ambalaj seçenekleri | UNKNOWN |