Chromotropic acid is a naphthalenesulfonic acid that is naphthalene-2,7-disulfonic acid substituted by hydroxy groups at positions 4 and 5. It has a role as an indicator. It is a member of naphthalenediols and a naphthalenesulfonic acid.
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
Chromotropic acid is a naphthalenesulfonic acid that is naphthalene-2,7-disulfonic acid substituted by hydroxy groups at positions 4 and 5. It has a role as an indicator. It is a member of naphthalenediols and a naphthalenesulfonic acid.
| Fiziksel görünüm | Dihydrate: White solid; [Merck Index] |
| IUPAC Adı | 4,5-dihydroxynaphthalene-2,7-disulfonic acid |
| Formule moléculaire | C10H8O8S2 |
| Masse moléculaire | 320.3 g/mol |
| CAS | 148-25-4 |
| SMILES | C1=C2C=C(C=C(C2=C(C=C1S(=O)(=O)O)O)O)S(=O)(=O)O |
| InChIKey | HLVXFWDLRHCZEI-UHFFFAOYSA-N |
| Katalog No | KC.310204 |
| Ambalaj seçenekleri | 25GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.