An essential amino acid that is required for the production of histamine.
Tahriş edici
⚠️ Bilgi amaçlıdır; resmî Güvenlik Bilgi Formu (SDS) yerine geçmez.
An essential amino acid that is required for the production of histamine.
| Fiziksel görünüm | Solid; [Merck Index] Powder; [Sigma-Aldrich MSDS] |
| Renk / Form | Needles or plates |
| Erime noktası | 287 °C (decomp) |
| Çözünürlük | Fairly sol in water; insol in alcohol and ether; decomp 251-252 °C; specific optical rotation (c= 2 in 3 moles of HCl): +8.0 deg at 26 °C/D /Monohydrochloride/ |
| Buhar basıncı | 0.00000001 [mmHg] |
| IUPAC Adı | (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid |
| Formule moléculaire | C6H9N3O2 |
| Masse moléculaire | 155.15 g/mol |
| CAS | 71-00-1 |
| SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)N |
| InChIKey | HNDVDQJCIGZPNO-YFKPBYRVSA-N |
| Katalog No | KC.1210032 |
| Ambalaj seçenekleri | 25GM · 100GM |
⚠️ Bilgi amaçlıdır; resmî SDS yerine geçmez.