C.i. acid orange 10 appears as orange microcrystals or powder. (NTP, 1992)
C.i. acid orange 10 appears as orange microcrystals or powder. (NTP, 1992)
| Fiziksel görünüm | C.i. acid orange 10 appears as orange microcrystals or powder. (NTP, 1992) |
| Erime noktası | 572 to 707 °F (decomposes) (NTP, 1992) |
| Çözünürlük | 50 to 100 mg/mL at 74.3 °F (NTP, 1992) |
| IUPAC Adı | disodium;7-hydroxy-8-phenyldiazenylnaphthalene-1,3-disulfonate |
| Formule moléculaire | C16H10N2Na2O7S2 |
| Masse moléculaire | 452.4 g/mol |
| CAS | 1936-15-8 |
| SMILES | C1=CC=C(C=C1)N=NC2=C(C=CC3=CC(=CC(=C32)S(=O)(=O)[O-])S(=O)(=O)[O-])O.[Na+].[Na+] |
| InChIKey | HSXUHWZMNJHFRV-UHFFFAOYSA-L |
| Katalog No | KC.1510209 |
| Ambalaj seçenekleri | 25GM · 100GM |