Nile blue A is an organic chloride salt having 5-amino-9-(diethylamino)benzo[a]phenoxazin-7-ium as the couterion. fluorescent dye which is also a potent photosensitiser for photodynamic therapy. It has a role as a fluorochrome and a histological dye. It contains a nile blue(1+).
| IUPAC Adı | (5-aminobenzo[a]phenoxazin-9-ylidene)-diethylazanium chloride |
| Molekulyar formula | C20H20ClN3O |
| Molekulyar og‘irlik | 353.8 g/mol |
| CAS | 2381-85-3 |
| SMILES | CC[N+](=C1C=CC2=NC3=C(C=C(C4=CC=CC=C43)N)OC2=C1)CC.[Cl-] |
| InChIKey | SHXOKQKTZJXHHR-UHFFFAOYSA-N |
| Katalog No | KC.1410111 |
| Ambalaj seçenekleri | 25GM |
